C20H18Cl2N2O — CID 5043299
N-tert-butyl-2-(3,4-dichlorophenyl)quinoline-4-carboxamide (PubChem CID 5043299) has the molecular formula C20H18Cl2N2O and a molecular weight of 373.28 g/mol. Its IUPAC name is N-tert-butyl-2-(3,4-dichlorophenyl)quinoline-4-carboxamide.
| Compound Name | N-tert-butyl-2-(3,4-dichlorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5043299 |
| Molecular Formula | C20H18Cl2N2O |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-tert-butyl-2-(3,4-dichlorophenyl)quinoline-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C20H18Cl2N2O/c1-20(2,3)24-19(25)14-11-18(12-8-9-15(21)16(22)10-12)23-17-7-5-4-6-13(14)17/h4-11H,1-3H3,(H,24,25) |
| InChIKey | YHRUGWLGRZUBNS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |