C22H12Cl4N2O — CID 3264826
N-(2,4-dichlorophenyl)-2-(3,4-dichlorophenyl)quinoline-4-carboxamide (PubChem CID 3264826) has the molecular formula C22H12Cl4N2O and a molecular weight of 462.16 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(3,4-dichlorophenyl)quinoline-4-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(3,4-dichlorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3264826 |
| Molecular Formula | C22H12Cl4N2O |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 459.97 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(3,4-dichlorophenyl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C22H12Cl4N2O/c23-13-6-8-20(18(26)10-13)28-22(29)15-11-21(12-5-7-16(24)17(25)9-12)27-19-4-2-1-3-14(15)19/h1-11H,(H,28,29) |
| InChIKey | PCARDIVJGWSOKC-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |