C23H13Cl2F3N2O — CID 3128616
2-(4-chlorophenyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]quinoline-4-carboxamide (PubChem CID 3128616) has the molecular formula C23H13Cl2F3N2O and a molecular weight of 461.27 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3128616 |
| Molecular Formula | C23H13Cl2F3N2O |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]quinoline-4-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H13Cl2F3N2O/c24-15-8-5-13(6-9-15)20-12-17(16-3-1-2-4-19(16)29-20)22(31)30-21-11-14(23(26,27)28)7-10-18(21)25/h1-12H,(H,30,31) |
| InChIKey | AIYLMKSYZJUIBT-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |