C23H16ClFN2O — CID 4196964
N-(4-chloro-2-fluorophenyl)-2-(3-methylphenyl)quinoline-4-carboxamide (PubChem CID 4196964) has the molecular formula C23H16ClFN2O and a molecular weight of 390.85 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(3-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(3-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4196964 |
| Molecular Formula | C23H16ClFN2O |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(3-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cccc(-c2cc(C(=O)Nc3ccc(Cl)cc3F)c3ccccc3n2)c1 |
| InChI | InChI=1S/C23H16ClFN2O/c1-14-5-4-6-15(11-14)22-13-18(17-7-2-3-8-20(17)26-22)23(28)27-21-10-9-16(24)12-19(21)25/h2-13H,1H3,(H,27,28) |
| InChIKey | DSNWQNJVXGULMI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |