C24H19N3O2 — CID 2886854
N-(2-carbamoylphenyl)-2-(3-methylphenyl)quinoline-4-carboxamide (PubChem CID 2886854) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-2-(3-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-2-(3-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2886854 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-(2-carbamoylphenyl)-2-(3-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cccc(-c2cc(C(=O)Nc3ccccc3C(N)=O)c3ccccc3n2)c1 |
| InChI | InChI=1S/C24H19N3O2/c1-15-7-6-8-16(13-15)22-14-19(17-9-2-4-11-20(17)26-22)24(29)27-21-12-5-3-10-18(21)23(25)28/h2-14H,1H3,(H2,25,28)(H,27,29) |
| InChIKey | ZXYNSIZWYBJXGN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |