C30H24N2O — CID 5129728
N-(2,3-dimethylphenyl)-2-(4-phenylphenyl)quinoline-4-carboxamide (PubChem CID 5129728) has the molecular formula C30H24N2O and a molecular weight of 428.54 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(4-phenylphenyl)quinoline-4-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(4-phenylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5129728 |
| Molecular Formula | C30H24N2O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(4-phenylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc(-c3ccc(-c4ccccc4)cc3)nc3ccccc23)c1C |
| InChI | InChI=1S/C30H24N2O/c1-20-9-8-14-27(21(20)2)32-30(33)26-19-29(31-28-13-7-6-12-25(26)28)24-17-15-23(16-18-24)22-10-4-3-5-11-22/h3-19H,1-2H3,(H,32,33) |
| InChIKey | UREAXABSQIYBSF-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |