C26H24N2O — CID 5141329
N-(2,3-dimethylphenyl)-2-(4-ethylphenyl)quinoline-4-carboxamide (PubChem CID 5141329) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(4-ethylphenyl)quinoline-4-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(4-ethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5141329 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(4-ethylphenyl)quinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)Nc3cccc(C)c3C)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H24N2O/c1-4-19-12-14-20(15-13-19)25-16-22(21-9-5-6-10-24(21)27-25)26(29)28-23-11-7-8-17(2)18(23)3/h5-16H,4H2,1-3H3,(H,28,29) |
| InChIKey | VMAPODPNCRYRFJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |