C31H25N3O2 — CID 17320376
N-[2-[(4-methylphenyl)methylcarbamoyl]phenyl]-2-phenylquinoline-4-carboxamide (PubChem CID 17320376) has the molecular formula C31H25N3O2 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)methylcarbamoyl]phenyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[2-[(4-methylphenyl)methylcarbamoyl]phenyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 17320376 |
| Molecular Formula | C31H25N3O2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[2-[(4-methylphenyl)methylcarbamoyl]phenyl]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccccc2NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C31H25N3O2/c1-21-15-17-22(18-16-21)20-32-30(35)25-12-6-8-14-28(25)34-31(36)26-19-29(23-9-3-2-4-10-23)33-27-13-7-5-11-24(26)27/h2-19H,20H2,1H3,(H,32,35)(H,34,36) |
| InChIKey | QLNZNNZPMLCYKK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |