C25H20N2O3 — CID 3532105
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 3532105) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3532105 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCc3ccc4c(c3)OCO4)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H20N2O3/c1-16-6-9-18(10-7-16)22-13-20(19-4-2-3-5-21(19)27-22)25(28)26-14-17-8-11-23-24(12-17)30-15-29-23/h2-13H,14-15H2,1H3,(H,26,28) |
| InChIKey | ZCYBPIWKGZOVJT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |