C24H18N2O3 — CID 1345651
N-(1,3-benzodioxol-5-ylmethyl)-2-phenylquinoline-4-carboxamide (PubChem CID 1345651) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 1345651 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C24H18N2O3/c27-24(25-14-16-10-11-22-23(12-16)29-15-28-22)19-13-21(17-6-2-1-3-7-17)26-20-9-5-4-8-18(19)20/h1-13H,14-15H2,(H,25,27) |
| InChIKey | LTGYLRAGPGGNJC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |