C22H20N2O4 — CID 1028519
2-(1,3-benzodioxol-5-yl)-N-[[(2R)-oxolan-2-yl]methyl]quinoline-4-carboxamide (PubChem CID 1028519) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[[(2R)-oxolan-2-yl]methyl]quinoline-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[[(2R)-oxolan-2-yl]methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 1028519 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[[(2R)-oxolan-2-yl]methyl]quinoline-4-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO1)c1cc(-c2ccc3c(c2)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C22H20N2O4/c25-22(23-12-15-4-3-9-26-15)17-11-19(24-18-6-2-1-5-16(17)18)14-7-8-20-21(10-14)28-13-27-20/h1-2,5-8,10-11,15H,3-4,9,12-13H2,(H,23,25)/t15-/m1/s1 |
| InChIKey | DQNPPMKRQHPMNX-OAHLLOKOSA-N |
| XLogP | 3.54 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |