2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid

C18H13NO4 — CID 91665266

IUPAC2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccc3c(c2)OCO3)nc2ccccc12
InChIInChI=1S/C18H13NO4/c20-18(21)9-12-7-15(19-14-4-2-1-3-13(12)14)11-5-6-16-17(8-11)23-10-22-16/h1-8H,9-10H2,(H,20,21)
InChIKeyBIODWLMMRCMKHH-UHFFFAOYSA-N
MW307.31 g/mol
LogP3.26
Rot. Bonds3

About 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid

2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid (PubChem CID 91665266) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid
PubChem CID91665266
Molecular FormulaC18H13NO4
Molecular Weight307.31 g/mol
Exact Mass307.08
IUPAC Name2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccc3c(c2)OCO3)nc2ccccc12
InChIInChI=1S/C18H13NO4/c20-18(21)9-12-7-15(19-14-4-2-1-3-13(12)14)11-5-6-16-17(8-11)23-10-22-16/h1-8H,9-10H2,(H,20,21)
InChIKeyBIODWLMMRCMKHH-UHFFFAOYSA-N
XLogP3.26
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.31
LogP ≤ 53.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid?
The IUPAC name of 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid (CID 91665266) is 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid?
The canonical SMILES for 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid is O=C(O)Cc1cc(-c2ccc3c(c2)OCO3)nc2ccccc12.
What is the InChIKey of 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid?
The InChIKey is BIODWLMMRCMKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO4/c20-18(21)9-12-7-15(19-14-4-2-1-3-13(12)14)11-5-6-16-17(8-11)23-10-22-16/h1-8H,9-10H2,(H,20,21).
What are the key properties of 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid?
2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid has a molecular weight of 307.31 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid is sourced from PubChem (CID 91665266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).