C18H13NO4 — CID 91665266
2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid (PubChem CID 91665266) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid |
|---|---|
| PubChem CID | 91665266 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)quinolin-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(-c2ccc3c(c2)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C18H13NO4/c20-18(21)9-12-7-15(19-14-4-2-1-3-13(12)14)11-5-6-16-17(8-11)23-10-22-16/h1-8H,9-10H2,(H,20,21) |
| InChIKey | BIODWLMMRCMKHH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |