C24H20N2O4 — CID 19715615
2-(1,3-benzodioxol-5-yl)quinoline-4-carboxylic acid;phenylmethanamine (PubChem CID 19715615) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)quinoline-4-carboxylic acid;phenylmethanamine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)quinoline-4-carboxylic acid;phenylmethanamine |
|---|---|
| PubChem CID | 19715615 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)quinoline-4-carboxylic acid;phenylmethanamine |
| SMILES | NCc1ccccc1.O=C(O)c1cc(-c2ccc3c(c2)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C17H11NO4.C7H9N/c19-17(20)12-8-14(18-13-4-2-1-3-11(12)13)10-5-6-15-16(7-10)22-9-21-15;8-6-7-4-2-1-3-5-7/h1-8H,9H2,(H,19,20);1-5H,6,8H2 |
| InChIKey | AJEIUZPCPNODQL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |