C18H12ClNO3 — CID 46779784
2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carbonyl chloride (PubChem CID 46779784) has the molecular formula C18H12ClNO3 and a molecular weight of 325.75 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carbonyl chloride.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carbonyl chloride |
|---|---|
| PubChem CID | 46779784 |
| Molecular Formula | C18H12ClNO3 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(-c2ccc3c(c2)OCCO3)nc2ccccc12 |
| InChI | InChI=1S/C18H12ClNO3/c19-18(21)13-10-15(20-14-4-2-1-3-12(13)14)11-5-6-16-17(9-11)23-8-7-22-16/h1-6,9-10H,7-8H2 |
| InChIKey | QIJBWABLTHWMFS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|