C23H14Cl2N2O3 — CID 5212111
2-(1,3-benzodioxol-5-yl)-N-(3,5-dichlorophenyl)quinoline-4-carboxamide (PubChem CID 5212111) has the molecular formula C23H14Cl2N2O3 and a molecular weight of 437.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(3,5-dichlorophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(3,5-dichlorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5212111 |
| Molecular Formula | C23H14Cl2N2O3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(3,5-dichlorophenyl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cc(-c2ccc3c(c2)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C23H14Cl2N2O3/c24-14-8-15(25)10-16(9-14)26-23(28)18-11-20(27-19-4-2-1-3-17(18)19)13-5-6-21-22(7-13)30-12-29-21/h1-11H,12H2,(H,26,28) |
| InChIKey | QBJPNDVXZSZITJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |