C24H17N3O5 — CID 5189265
2-(1,3-benzodioxol-5-yl)-N-(2-methyl-4-nitrophenyl)quinoline-4-carboxamide (PubChem CID 5189265) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(2-methyl-4-nitrophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(2-methyl-4-nitrophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5189265 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(2-methyl-4-nitrophenyl)quinoline-4-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)c1cc(-c2ccc3c(c2)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C24H17N3O5/c1-14-10-16(27(29)30)7-8-19(14)26-24(28)18-12-21(25-20-5-3-2-4-17(18)20)15-6-9-22-23(11-15)32-13-31-22/h2-12H,13H2,1H3,(H,26,28) |
| InChIKey | YUCONPDFAQCCCN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|