C21H14ClN3O3S — CID 4591737
N-(2-chloro-4-nitrophenyl)-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide (PubChem CID 4591737) has the molecular formula C21H14ClN3O3S and a molecular weight of 423.88 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4591737 |
| Molecular Formula | C21H14ClN3O3S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)c3ccccc3n2)s1 |
| InChI | InChI=1S/C21H14ClN3O3S/c1-12-6-9-20(29-12)19-11-15(14-4-2-3-5-17(14)23-19)21(26)24-18-8-7-13(25(27)28)10-16(18)22/h2-11H,1H3,(H,24,26) |
| InChIKey | OENCZLNAYAEDEU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|