C22H14ClF3N2OS — CID 5207442
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide (PubChem CID 5207442) has the molecular formula C22H14ClF3N2OS and a molecular weight of 446.88 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5207442 |
| Molecular Formula | C22H14ClF3N2OS |
| Molecular Weight | 446.88 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3cc(C(F)(F)F)ccc3Cl)c3ccccc3n2)s1 |
| InChI | InChI=1S/C22H14ClF3N2OS/c1-12-6-9-20(30-12)19-11-15(14-4-2-3-5-17(14)27-19)21(29)28-18-10-13(22(24,25)26)7-8-16(18)23/h2-11H,1H3,(H,28,29) |
| InChIKey | GQVYUUNJDLJVRE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.88 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |