C23H21N5O3 — CID 19512081
2-(1-ethyl-5-methylpyrazol-4-yl)-N-(2-methyl-4-nitrophenyl)quinoline-4-carboxamide (PubChem CID 19512081) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(2-methyl-4-nitrophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(2-methyl-4-nitrophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19512081 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(2-methyl-4-nitrophenyl)quinoline-4-carboxamide |
| SMILES | CCn1ncc(-c2cc(C(=O)Nc3ccc([N+](=O)[O-])cc3C)c3ccccc3n2)c1C |
| InChI | InChI=1S/C23H21N5O3/c1-4-27-15(3)19(13-24-27)22-12-18(17-7-5-6-8-21(17)25-22)23(29)26-20-10-9-16(28(30)31)11-14(20)2/h5-13H,4H2,1-3H3,(H,26,29) |
| InChIKey | IXUZIWTUGYBZSO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|