C22H19N5O4 — CID 19512305
2-(1-ethyl-5-methylpyrazol-4-yl)-N-(2-hydroxy-4-nitrophenyl)quinoline-4-carboxamide (PubChem CID 19512305) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(2-hydroxy-4-nitrophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(2-hydroxy-4-nitrophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19512305 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(2-hydroxy-4-nitrophenyl)quinoline-4-carboxamide |
| SMILES | CCn1ncc(-c2cc(C(=O)Nc3ccc([N+](=O)[O-])cc3O)c3ccccc3n2)c1C |
| InChI | InChI=1S/C22H19N5O4/c1-3-26-13(2)17(12-23-26)20-11-16(15-6-4-5-7-18(15)24-20)22(29)25-19-9-8-14(27(30)31)10-21(19)28/h4-12,28H,3H2,1-2H3,(H,25,29) |
| InChIKey | FXGYZFLUXDHMFT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|