C24H24N4O4S — CID 19512302
2-(1-ethyl-5-methylpyrazol-4-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)quinoline-4-carboxamide (PubChem CID 19512302) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19512302 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-(1-ethyl-5-methylpyrazol-4-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)quinoline-4-carboxamide |
| SMILES | CCn1ncc(-c2cc(C(=O)Nc3cc(S(=O)(=O)CC)ccc3O)c3ccccc3n2)c1C |
| InChI | InChI=1S/C24H24N4O4S/c1-4-28-15(3)19(14-25-28)21-13-18(17-8-6-7-9-20(17)26-21)24(30)27-22-12-16(10-11-23(22)29)33(31,32)5-2/h6-14,29H,4-5H2,1-3H3,(H,27,30) |
| InChIKey | JHGRKCFRWNXPHI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|