C13H10N2O4 — CID 82483287
2-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]acetic acid (PubChem CID 82483287) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]acetic acid.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 82483287 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]acetic acid |
| SMILES | O=C(O)Cc1nccc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H10N2O4/c16-13(17)6-12-14-4-3-9(15-12)8-1-2-10-11(5-8)19-7-18-10/h1-5H,6-7H2,(H,16,17) |
| InChIKey | NFFKAJREBHLGJV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |