C12H8N2O3 — CID 83918199
4-(1,3-benzodioxol-5-yl)pyrimidine-2-carbaldehyde (PubChem CID 83918199) has the molecular formula C12H8N2O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)pyrimidine-2-carbaldehyde.
| Compound Name | 4-(1,3-benzodioxol-5-yl)pyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 83918199 |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)pyrimidine-2-carbaldehyde |
| SMILES | O=Cc1nccc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H8N2O3/c15-6-12-13-4-3-9(14-12)8-1-2-10-11(5-8)17-7-16-10/h1-6H,7H2 |
| InChIKey | CNDDSUXEHJCAHS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|