C11H7NO3S — CID 61282299
2-(1,3-benzodioxol-5-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 61282299) has the molecular formula C11H7NO3S and a molecular weight of 233.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 61282299 |
| Molecular Formula | C11H7NO3S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C11H7NO3S/c13-5-8-4-12-11(16-8)7-1-2-9-10(3-7)15-6-14-9/h1-5H,6H2 |
| InChIKey | GMQVTXAJDMGKFC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|