C11H7NO4 — CID 53407581
2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carbaldehyde (PubChem CID 53407581) has the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carbaldehyde.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 53407581 |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carbaldehyde |
| SMILES | O=Cc1coc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C11H7NO4/c13-4-8-5-14-11(12-8)7-1-2-9-10(3-7)16-6-15-9/h1-5H,6H2 |
| InChIKey | LKKAPSMWLSOIEN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|