C9H6N2O3 — CID 2372912
2-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazole (PubChem CID 2372912) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2372912 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazole |
| SMILES | c1nnc(-c2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C9H6N2O3/c1-2-7-8(14-5-13-7)3-6(1)9-11-10-4-12-9/h1-4H,5H2 |
| InChIKey | ZVZVERHQRHUEKO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |