C9H7N3O3 — CID 63692453
5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-amine (PubChem CID 63692453) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 63692453 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C9H7N3O3/c10-9-11-8(15-12-9)5-1-2-6-7(3-5)14-4-13-6/h1-3H,4H2,(H2,10,12) |
| InChIKey | RSCMAKUZYPFFNK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |