C13H12N2O2 — CID 22478061
4-(1,3-benzodioxol-5-yl)benzene-1,2-diamine (PubChem CID 22478061) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)benzene-1,2-diamine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 22478061 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)benzene-1,2-diamine |
| SMILES | Nc1ccc(-c2ccc3c(c2)OCO3)cc1N |
| InChI | InChI=1S/C13H12N2O2/c14-10-3-1-8(5-11(10)15)9-2-4-12-13(6-9)17-7-16-12/h1-6H,7,14-15H2 |
| InChIKey | IQONOBNNOJISSP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|