C14H14N2O2 — CID 139679587
4-(aminomethyl)-2-(1,3-benzodioxol-5-yl)aniline (PubChem CID 139679587) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-(aminomethyl)-2-(1,3-benzodioxol-5-yl)aniline.
| Compound Name | 4-(aminomethyl)-2-(1,3-benzodioxol-5-yl)aniline |
|---|---|
| PubChem CID | 139679587 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(aminomethyl)-2-(1,3-benzodioxol-5-yl)aniline |
| SMILES | NCc1ccc(N)c(-c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C14H14N2O2/c15-7-9-1-3-12(16)11(5-9)10-2-4-13-14(6-10)18-8-17-13/h1-6H,7-8,15-16H2 |
| InChIKey | RXTTYJACIZYJLH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|