C17H14N2O2S — CID 39197619
[4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]phenyl]methanamine (PubChem CID 39197619) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is [4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]phenyl]methanamine.
| Compound Name | [4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 39197619 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | [4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]phenyl]methanamine |
| SMILES | NCc1ccc(-c2nc(-c3ccc4c(c3)OCO4)cs2)cc1 |
| InChI | InChI=1S/C17H14N2O2S/c18-8-11-1-3-12(4-2-11)17-19-14(9-22-17)13-5-6-15-16(7-13)21-10-20-15/h1-7,9H,8,10,18H2 |
| InChIKey | XTCLQMLQNKOLLH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |