C12H10N2O3S — CID 9174003
2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 9174003) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9174003 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | NC(=O)Cc1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C12H10N2O3S/c13-11(15)4-12-14-8(5-18-12)7-1-2-9-10(3-7)17-6-16-9/h1-3,5H,4,6H2,(H2,13,15) |
| InChIKey | DVECXDMCEIPHJR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |