C14H13NO3S — CID 94283855
4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]butan-2-one (PubChem CID 94283855) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]butan-2-one.
| Compound Name | 4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]butan-2-one |
|---|---|
| PubChem CID | 94283855 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]butan-2-one |
| SMILES | CC(=O)CCc1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C14H13NO3S/c1-9(16)2-5-14-15-11(7-19-14)10-3-4-12-13(6-10)18-8-17-12/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | GEDFMYLEWMJQER-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |