C19H16N2O3S — CID 110426325
N-(1,3-benzodioxol-5-yl)-3-(4-phenyl-1,3-thiazol-2-yl)propanamide (PubChem CID 110426325) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(4-phenyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(4-phenyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 110426325 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(4-phenyl-1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCc1nc(-c2ccccc2)cs1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16N2O3S/c22-18(20-14-6-7-16-17(10-14)24-12-23-16)8-9-19-21-15(11-25-19)13-4-2-1-3-5-13/h1-7,10-11H,8-9,12H2,(H,20,22) |
| InChIKey | UFXOQDVOKJDBCU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |