C16H18N2O3S — CID 39072128
N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-ethylbutanamide (PubChem CID 39072128) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-ethylbutanamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 39072128 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C16H18N2O3S/c1-3-10(4-2)15(19)18-16-17-12(8-22-16)11-5-6-13-14(7-11)21-9-20-13/h5-8,10H,3-4,9H2,1-2H3,(H,17,18,19) |
| InChIKey | GGMWMMDBFDJXMM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |