C17H22N2O3S — CID 112794584
N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-ethylbutanamide (PubChem CID 112794584) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-ethylbutanamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 112794584 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1nc(-c2ccc(OC)c(OC)c2)cs1 |
| InChI | InChI=1S/C17H22N2O3S/c1-5-11(6-2)16(20)19-17-18-13(10-23-17)12-7-8-14(21-3)15(9-12)22-4/h7-11H,5-6H2,1-4H3,(H,18,19,20) |
| InChIKey | ITHFREDJOAPAKY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |