C21H20ClN3O5S — CID 23999967
[1-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate (PubChem CID 23999967) has the molecular formula C21H20ClN3O5S and a molecular weight of 461.93 g/mol. Its IUPAC name is [1-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate.
| Compound Name | [1-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 23999967 |
| Molecular Formula | C21H20ClN3O5S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | [1-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate |
| SMILES | CCC(OC(=O)c1cccnc1Cl)C(=O)Nc1nc(-c2ccc(OC)c(OC)c2)cs1 |
| InChI | InChI=1S/C21H20ClN3O5S/c1-4-15(30-20(27)13-6-5-9-23-18(13)22)19(26)25-21-24-14(11-31-21)12-7-8-16(28-2)17(10-12)29-3/h5-11,15H,4H2,1-3H3,(H,24,25,26) |
| InChIKey | DYXFFTXALJOKRI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|