C21H20ClN3O4S — CID 23831957
[1-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 2-chloropyridine-4-carboxylate (PubChem CID 23831957) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is [1-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 2-chloropyridine-4-carboxylate.
| Compound Name | [1-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 23831957 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | [1-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 2-chloropyridine-4-carboxylate |
| SMILES | CCOc1ccc(-c2csc(NC(=O)C(CC)OC(=O)c3ccnc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C21H20ClN3O4S/c1-3-17(29-20(27)14-9-10-23-18(22)11-14)19(26)25-21-24-16(12-30-21)13-5-7-15(8-6-13)28-4-2/h5-12,17H,3-4H2,1-2H3,(H,24,25,26) |
| InChIKey | CPRHKSUDHZCHIT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|