C20H18BrN3O3S — CID 23944140
[1-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 3-aminobenzoate (PubChem CID 23944140) has the molecular formula C20H18BrN3O3S and a molecular weight of 460.35 g/mol. Its IUPAC name is [1-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 3-aminobenzoate.
| Compound Name | [1-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 3-aminobenzoate |
|---|---|
| PubChem CID | 23944140 |
| Molecular Formula | C20H18BrN3O3S |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | [1-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl] 3-aminobenzoate |
| SMILES | CCC(OC(=O)c1cccc(N)c1)C(=O)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C20H18BrN3O3S/c1-2-17(27-19(26)13-4-3-5-15(22)10-13)18(25)24-20-23-16(11-28-20)12-6-8-14(21)9-7-12/h3-11,17H,2,22H2,1H3,(H,23,24,25) |
| InChIKey | PLKICHGKJMPGTI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|