C19H16BrN3O3S — CID 23888061
[1-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-aminobenzoate (PubChem CID 23888061) has the molecular formula C19H16BrN3O3S and a molecular weight of 446.33 g/mol. Its IUPAC name is [1-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-aminobenzoate.
| Compound Name | [1-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-aminobenzoate |
|---|---|
| PubChem CID | 23888061 |
| Molecular Formula | C19H16BrN3O3S |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | [1-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-aminobenzoate |
| SMILES | CC(OC(=O)c1cccc(N)c1)C(=O)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C19H16BrN3O3S/c1-11(26-18(25)13-3-2-4-15(21)9-13)17(24)23-19-22-16(10-27-19)12-5-7-14(20)8-6-12/h2-11H,21H2,1H3,(H,22,23,24) |
| InChIKey | USFOPGTVWUYRDH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|