C13H13N3O3S — CID 23744803
[1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl] 3-aminobenzoate (PubChem CID 23744803) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is [1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl] 3-aminobenzoate.
| Compound Name | [1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl] 3-aminobenzoate |
|---|---|
| PubChem CID | 23744803 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | [1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl] 3-aminobenzoate |
| SMILES | CC(OC(=O)c1cccc(N)c1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H13N3O3S/c1-8(11(17)16-13-15-5-6-20-13)19-12(18)9-3-2-4-10(14)7-9/h2-8H,14H2,1H3,(H,15,16,17) |
| InChIKey | WYFQJOGSFRPXJO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|