C12H10Cl2N2O2S — CID 43077311
2-(2,3-dichlorophenoxy)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 43077311) has the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.20 g/mol. Its IUPAC name is 2-(2,3-dichlorophenoxy)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-(2,3-dichlorophenoxy)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 43077311 |
| Molecular Formula | C12H10Cl2N2O2S |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 2-(2,3-dichlorophenoxy)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CC(Oc1cccc(Cl)c1Cl)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H10Cl2N2O2S/c1-7(11(17)16-12-15-5-6-19-12)18-9-4-2-3-8(13)10(9)14/h2-7H,1H3,(H,15,16,17) |
| InChIKey | QRAZVEXMLJZNBY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |