C15H11Cl4NO2 — CID 7787703
(2R)-2-(2,3-dichlorophenoxy)-N-(3,5-dichlorophenyl)propanamide (PubChem CID 7787703) has the molecular formula C15H11Cl4NO2 and a molecular weight of 379.07 g/mol. Its IUPAC name is (2R)-2-(2,3-dichlorophenoxy)-N-(3,5-dichlorophenyl)propanamide.
| Compound Name | (2R)-2-(2,3-dichlorophenoxy)-N-(3,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 7787703 |
| Molecular Formula | C15H11Cl4NO2 |
| Molecular Weight | 379.07 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | (2R)-2-(2,3-dichlorophenoxy)-N-(3,5-dichlorophenyl)propanamide |
| SMILES | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl4NO2/c1-8(22-13-4-2-3-12(18)14(13)19)15(21)20-11-6-9(16)5-10(17)7-11/h2-8H,1H3,(H,20,21)/t8-/m1/s1 |
| InChIKey | WWMHHRDQLPLXCZ-MRVPVSSYSA-N |
| XLogP | 5.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.07 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |