C16H12Cl2N2O2 — CID 42990430
N-(4-cyanophenyl)-2-(2,3-dichlorophenoxy)propanamide (PubChem CID 42990430) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(2,3-dichlorophenoxy)propanamide.
| Compound Name | N-(4-cyanophenyl)-2-(2,3-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 42990430 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(4-cyanophenyl)-2-(2,3-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1cccc(Cl)c1Cl)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H12Cl2N2O2/c1-10(22-14-4-2-3-13(17)15(14)18)16(21)20-12-7-5-11(9-19)6-8-12/h2-8,10H,1H3,(H,20,21) |
| InChIKey | MVZGXMKWQPDFTJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |