C17H15ClN2O2 — CID 8976723
(2R)-2-(2-chloro-4-cyanophenoxy)-N-(3-methylphenyl)propanamide (PubChem CID 8976723) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is (2R)-2-(2-chloro-4-cyanophenoxy)-N-(3-methylphenyl)propanamide.
| Compound Name | (2R)-2-(2-chloro-4-cyanophenoxy)-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 8976723 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (2R)-2-(2-chloro-4-cyanophenoxy)-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)[C@@H](C)Oc2ccc(C#N)cc2Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O2/c1-11-4-3-5-14(8-11)20-17(21)12(2)22-16-7-6-13(10-19)9-15(16)18/h3-9,12H,1-2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | DCBYGDUTGGHPGO-GFCCVEGCSA-N |
| XLogP | 3.93 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |