C16H11Cl2FN2O2 — CID 9383960
(2S)-2-(2-chloro-4-cyanophenoxy)-N-(3-chloro-4-fluorophenyl)propanamide (PubChem CID 9383960) has the molecular formula C16H11Cl2FN2O2 and a molecular weight of 353.18 g/mol. Its IUPAC name is (2S)-2-(2-chloro-4-cyanophenoxy)-N-(3-chloro-4-fluorophenyl)propanamide.
| Compound Name | (2S)-2-(2-chloro-4-cyanophenoxy)-N-(3-chloro-4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 9383960 |
| Molecular Formula | C16H11Cl2FN2O2 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (2S)-2-(2-chloro-4-cyanophenoxy)-N-(3-chloro-4-fluorophenyl)propanamide |
| SMILES | C[C@H](Oc1ccc(C#N)cc1Cl)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2FN2O2/c1-9(23-15-5-2-10(8-20)6-13(15)18)16(22)21-11-3-4-14(19)12(17)7-11/h2-7,9H,1H3,(H,21,22)/t9-/m0/s1 |
| InChIKey | LBUFDKGMRPDDKI-VIFPVBQESA-N |
| XLogP | 4.41 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |