C16H11Cl3N2O2 — CID 16529582
N-(3-cyanophenyl)-2-(2,4,5-trichlorophenoxy)propanamide (PubChem CID 16529582) has the molecular formula C16H11Cl3N2O2 and a molecular weight of 369.64 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(2,4,5-trichlorophenoxy)propanamide.
| Compound Name | N-(3-cyanophenyl)-2-(2,4,5-trichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 16529582 |
| Molecular Formula | C16H11Cl3N2O2 |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | N-(3-cyanophenyl)-2-(2,4,5-trichlorophenoxy)propanamide |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C16H11Cl3N2O2/c1-9(23-15-7-13(18)12(17)6-14(15)19)16(22)21-11-4-2-3-10(5-11)8-20/h2-7,9H,1H3,(H,21,22) |
| InChIKey | GRPXJAVBTXEYNP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|