C17H16Cl2N2O4 — CID 43078117
N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(2,3-dichlorophenoxy)propanamide (PubChem CID 43078117) has the molecular formula C17H16Cl2N2O4 and a molecular weight of 383.23 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(2,3-dichlorophenoxy)propanamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(2,3-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 43078117 |
| Molecular Formula | C17H16Cl2N2O4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(2,3-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1cccc(Cl)c1Cl)C(=O)Nc1cccc(OCC(N)=O)c1 |
| InChI | InChI=1S/C17H16Cl2N2O4/c1-10(25-14-7-3-6-13(18)16(14)19)17(23)21-11-4-2-5-12(8-11)24-9-15(20)22/h2-8,10H,9H2,1H3,(H2,20,22)(H,21,23) |
| InChIKey | CHEZKTMFBMJPMZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |