C17H16Cl2N2O3 — CID 38939684
N-[3-(2-amino-2-oxoethoxy)phenyl]-3-(2,3-dichlorophenyl)propanamide (PubChem CID 38939684) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)phenyl]-3-(2,3-dichlorophenyl)propanamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-3-(2,3-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 38939684 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-3-(2,3-dichlorophenyl)propanamide |
| SMILES | NC(=O)COc1cccc(NC(=O)CCc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c18-14-6-1-3-11(17(14)19)7-8-16(23)21-12-4-2-5-13(9-12)24-10-15(20)22/h1-6,9H,7-8,10H2,(H2,20,22)(H,21,23) |
| InChIKey | NIVRQAUMEJCTSA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |