C19H19Cl2NO4 — CID 55706670
ethyl 2-[3-[3-(2,3-dichlorophenyl)propanoylamino]phenoxy]acetate (PubChem CID 55706670) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is ethyl 2-[3-[3-(2,3-dichlorophenyl)propanoylamino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[3-(2,3-dichlorophenyl)propanoylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 55706670 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | ethyl 2-[3-[3-(2,3-dichlorophenyl)propanoylamino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NC(=O)CCc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO4/c1-2-25-18(24)12-26-15-7-4-6-14(11-15)22-17(23)10-9-13-5-3-8-16(20)19(13)21/h3-8,11H,2,9-10,12H2,1H3,(H,22,23) |
| InChIKey | AJBLTHRJWIVUFM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |