C13H14Cl2O4 — CID 78877457
(2-ethoxy-2-oxoethyl) 3-(2,3-dichlorophenyl)propanoate (PubChem CID 78877457) has the molecular formula C13H14Cl2O4 and a molecular weight of 305.16 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 3-(2,3-dichlorophenyl)propanoate.
| Compound Name | (2-ethoxy-2-oxoethyl) 3-(2,3-dichlorophenyl)propanoate |
|---|---|
| PubChem CID | 78877457 |
| Molecular Formula | C13H14Cl2O4 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 3-(2,3-dichlorophenyl)propanoate |
| SMILES | CCOC(=O)COC(=O)CCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl2O4/c1-2-18-12(17)8-19-11(16)7-6-9-4-3-5-10(14)13(9)15/h3-5H,2,6-8H2,1H3 |
| InChIKey | PWEZLRPXHRDEOX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |